On Target ADRB2_HUMAN 0.40136054/CHEMBL1598434
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.40136054, the most similar ligand is CHEMBL1598434. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL1598434 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN(CC(=O)N1CCN(CC1)c2ccccn2)S(=O)(=O)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 0000c092 00802200 01004020 05b00600 000c8000 10000000 00020000 00000008 00000000 20000a40 00202004 6000a800 02008806 00002001 80200000 00148004 00042000 00004000 08600000 00a06400 c0140000 2e008701 20800822 2a60002a 02002000 00000004 10000080 0000008c 08008418 20060801 00005002 00030260 |