On Target PPARG_HUMAN 0.39/CHEMBL386307
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.39, the most similar ligand is CHEMBL386307. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL386307 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | FC(F)(F)c1cccc(Cn2c(cc3ccccc23)C(=O)NS(=O)(=O)c4ccccc4C(F)(F)F)c1 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000012 00829a00 01180100 11b10600 000c1021 00000008 04000401 00011005 80100000 000038d0 00b9200c 60018402 40009800 01500001 90320040 0204000c 02002088 02100004 02680000 00006000 c0000000 18078618 20802000 8940000c 02102000 c0000004 c8000000 9000000c 04000404 20060049 80140200 00014360 |