On Target CHLE_HUMAN 0.3553719/CHEMBL3628054
For the given ligand Dolutegravir, we have found in our database that, being scored 0.3553719, the most similar ligand is CHEMBL3628054. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3628054 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | [Br-].Fc1ccccc1C[n+]2cccc(c2)C(=O)NCCc3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10000002 00809a00 00104100 43010610 00041000 00000010 00006000 02001004 00500080 000928c0 09200004 40018000 10009822 00401000 00000440 00040004 02020200 82000004 00200400 00000200 c0000000 18248e18 20800000 9140001c 00042000 c0000000 08000000 90000001 04400100 0006804b a00c0208 80000620 |