On Target PDE4B_HUMAN 0.46666667/CHEMBL3288021
For the given ligand Dolutegravir, we have found in our database that, being scored 0.46666667, the most similar ligand is CHEMBL3288021. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3288021 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | C[C@@H]1CN(Cc2ccc(cc2)c3cccc(Oc4ncc(F)cc4C(=O)N[C@@H]5CC[C@@H](CC5)NC(=O)c6ncccc6O)c3)C[C@H](C)N1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10002002 41809818 60104108 16010e10 80041020 00120124 06004400 22603401 00200104 001128d0 09290004 40038000 81008806 00103000 21020521 0214210d 10020040 02002006 06282000 10421201 c5420000 38078e10 30803021 0250011c 00142400 c0000001 08000840 90200041 084043a4 00060001 a5061c00 84006200 |