On Target ACM4_HUMAN 0.38265306/CHEMBL4060443
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.38265306, the most similar ligand is CHEMBL4060443. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL4060443 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | C[C@H]1CCCCN1c2ccc(nn2)N3CCN(CC3)S(=O)(=O)c4ccccc4C(F)(F)F |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004093 01801009 21100120 05b10600 20080000 00002008 00820400 20010000 00000000 10000ad0 0020200c 70018000 40000002 01002001 80320000 0014c00c 00042080 02000008 08602000 00226605 80100000 3c040010 20800820 2a50803a 02122000 80000004 20000000 900000cc 08000418 20060000 00100c02 20310260 |