On Target ACM4_HUMAN 0.3676976/CHEMBL107679
For the given ligand Dolutegravir, we have found in our database that, being scored 0.3676976, the most similar ligand is CHEMBL107679. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL107679 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCOC(=O)c1c(C)n(CC)c2ccc3OC4N(CCc5cc(OC)ccc45)Cc3c12 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0400000a 42809808 60100109 90010610 00041030 8000c500 161c0000 22021404 14400380 00180cc0 48200004 40018800 80808886 2061a000 01020441 0a1e200c 00022209 82888024 00290002 40020200 c0020840 18268a78 20804000 81d0301c 00046400 c0012222 086a4040 90000000 04400305 00060042 e40c8204 00000620 |