On Target BACE1_HUMAN 0.33467743/CHEMBL1097346
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.33467743, the most similar ligand is CHEMBL1097346. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL1097346 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CCNc1cc(cc(c1)C(=O)N[C@@H](Cc2cc(F)cc(F)c2)[C@H](O)[C@H]3CN(CCN3)S(=O)(=O)c4cccc(C)c4)N(C)S(=O)(=O)C |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 1000409a 03805c00 41100302 07b10600 00080180 08010010 00020800 22001004 00b00880 004929f0 08302004 f0038000 00008c02 00203001 817814c0 100a8108 10042000 02400400 08e02000 00006605 c0100100 382e8e10 230000e1 bb50003c 020c0081 c0100004 80008400 9000108d 2cf08506 20068017 a0040002 00010670 |