On Target DRD2_HUMAN 0.45086706/CHEMBL4081383
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.45086706, the most similar ligand is CHEMBL4081383. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL4081383 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | FC(F)(F)c1cccc(c1)N2CCN(CCC3CCN(CC3)S(=O)(=O)c4cccc5ncccc45)CC2 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004052 01800000 41104120 05b10600 000c0000 00000000 00010400 20000000 00000000 00400ad0 00202004 70018004 00000803 01402001 80600040 00040004 00042010 02000000 08600000 00006611 e0100000 38008028 20800021 9a50001a 02040000 80000004 00000000 9000008c 08408400 20060000 00140000 00010270 |