On Target DRD2_HUMAN 0.40942028/CHEMBL4093477
For the given ligand Dolutegravir, we have found in our database that, being scored 0.40942028, the most similar ligand is CHEMBL4093477. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL4093477 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCCN(CCCCNC(=O)c1cc2ccccc2[nH]1)[C@H]3CN4C(=O)N(CCC)c5cccc(C3)c45 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00000002 00009e00 00101100 51850f10 001c4060 00104140 00002000 22003001 04700981 800908e0 2d39900c 40038000 18009802 01d00800 00320cc0 020c1104 00800000 82800006 00600000 40000201 c0000100 38278638 21802001 9370041c 1c142000 c0000000 00000040 90000010 8c000104 0046001b e00c0204 00006ea0 |