On Target NEP_HUMAN 0.2532751/CHEMBL298388
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.2532751, the most similar ligand is CHEMBL298388. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL298388 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | OC(=O)CN1C(=O)[C@H](CSc2ccccc12)NC(=O)[C@@H](S)Cc3ccccc3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004002 00806200 20121120 0c110640 20000080 80000000 80004000 20000008 00020800 0b0f4ac0 08784004 6000b000 06018002 00142101 821a0040 000c000a 14040000 02030000 08000008 00420301 c0300110 38000e00 22c02201 0648001b 00006a00 80000780 08004000 180100c0 08008000 0006002b 3000f000 03010620 |