On Target NEP_HUMAN 0.23770492/CHEMBL211943
For the given ligand Hydralazine, we have found in our database that, being scored 0.23770492, the most similar ligand is CHEMBL211943. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL211943 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CCCC(CC1(CCCC1)C(=O)Nc2ccc(OC)nn2)C(=O)O |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00014003 01000019 20100008 00000600 20081000 00002000 00880000 00100008 00000000 10020080 00380004 60011000 0400c03e 01900000 01820000 001c401c 00040000 00004808 08602000 00220405 00140080 1c000e10 21812800 00108010 00124800 00000040 20040000 100000c0 00000208 01060001 00020400 00000200 |