On Target HPGDS_HUMAN 0.26548672/CHEMBL1490019
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.26548672, the most similar ligand is CHEMBL1490019. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL1490019 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Cc1nc(sc1C(=O)Nc2ccc(cc2)S(=O)(=O)N)c3ccccc3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 10024012 00802000 01000902 10b10618 00040210 00028000 00404080 0c1bd048 00000000 10000851 00282a04 70008200 00008010 00300021 802220c0 000c0204 01041000 02006080 08200010 84402201 d1121000 08080e80 20012000 38410108 02041000 8c000002 00200000 800032cc 0804800c 24261001 80100820 82010220 |