On Target NOS1_HUMAN 0.25603864/CHEMBL3142587
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.25603864, the most similar ligand is CHEMBL3142587. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3142587 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Cl.Cl.CNC1CCC(CC1)N2CCc3cc(NC(=N)c4cccs4)ccc23 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00014002 01001010 42100100 00010600 20040000 00002040 00000080 22001200 00600180 000808d3 08200204 4003c080 00000892 00001020 00022140 00080002 00049000 03000008 0a202000 00000209 44121000 58248090 20010000 81500011 02040000 84000002 40000000 90001084 04488318 00060002 02000000 24c32600 |