On Target OPRK_HUMAN 0.44015443/CHEMBL3698799
For the given ligand Dolutegravir, we have found in our database that, being scored 0.44015443, the most similar ligand is CHEMBL3698799. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3698799 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | OC(=O)c1ccc(CNC(=O)C2=Nc3ccccc3N([C@H]4C[C@H]5CC[C@@H](C4)N5C6CCCCCCC6)C2=O)nc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10000022 01805c00 00104900 50040e10 000c1062 001040d0 0000c006 22003003 16200101 800019f0 0d290004 50018000 80009802 08d40000 009604c0 0a0c010c 08122000 82000006 00602000 00000a01 c0000080 18048e50 21806000 0070001c 00140000 c0000000 08808040 90001004 00400104 00060811 c00e0000 80006200 |