On Target ALDR_HUMAN 0.50898206/CHEMBL240719
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.50898206, the most similar ligand is CHEMBL240719. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL240719 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Cc1ccccc1CC(=O)Nc2cc(C)c(c(C)c2)S(=O)(=O)NCC(=O)O |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004012 00802000 41100100 01b10600 24088031 00000008 00000000 00000008 00040000 00080850 08282004 6000b000 01008000 00300001 c0320040 00080008 00042280 02000000 08400000 00006400 c0140000 18200e01 22106000 c9400059 02042000 80000104 00000000 000000cc 04408400 20060003 00002000 00010660 |