On Target AA1R_HUMAN 0.36057693/CHEMBL210585
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.36057693, the most similar ligand is CHEMBL210585. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL210585 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CN1C(=O)N(C)c2[nH]c(nc2C1=O)c3ccc(cc3)S(=O)(=O)NCCc4ccccc4 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0000807a 20801800 01180100 13b10600 00080068 0000c000 00019200 00080408 16400100 904818e0 0c00a00c 60008800 02009001 00501001 802a0080 080c000c 00802000 0200a000 00400000 00406400 80000100 38000040 21802041 9970001c 02040000 c0200004 60000000 0004002c 04004405 20460c02 c0000800 400106e0 |