On Target ACM1_HUMAN 0.34895834/CHEMBL2057775
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.34895834, the most similar ligand is CHEMBL2057775. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL2057775 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | Cc1cc(ccn1)N2CCN(CC2)C(=O)C3CN(C3)S(=O)(=O)c4cccc5cnccc45 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000012 00802400 41104120 15b00600 000c0020 00000000 00008000 00000008 10000000 00400b70 00202014 60009000 08008802 00402001 80e20041 02040004 00046004 02000000 00600010 00007e03 c0100000 38048608 20800021 9a40001a 02040000 8000010c 00008040 0000008c 08000404 20060011 00040000 00010260 |