On Target ACM1_HUMAN 0.2990654/CHEMBL3360955
For the given ligand Hydralazine, we have found in our database that, being scored 0.2990654, the most similar ligand is CHEMBL3360955. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3360955 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | O=C1NN=C2C1=CN(Cc3ccc(cc3)n4cccn4)c5ccccc25 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00000006 00000a08 20004100 80050600 000c0000 00004060 06000000 00001000 06100100 c00108c0 01000004 40018000 80008806 00e00000 00000040 000d000c 00000000 02004000 00600000 00220000 40000000 1c018038 20800840 83700000 00102000 80000000 00000000 000c0000 04000000 00460008 40040000 800044a0 |