On Target CNR1_HUMAN 0.57615894/CHEMBL3975498
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.57615894, the most similar ligand is CHEMBL3975498. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3975498 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CC(C)(NS(=O)(=O)c1ccc(NC2CC3CCC2C3)cc1C(F)(F)F)C4CC4 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004012 01802000 41100100 01b10600 20080010 00002008 00000400 00010008 00000000 004008d0 0020200c 60018004 40000000 01000001 80720040 00000000 00042080 02000000 0a402000 00006411 c0100000 18000010 20000000 18500018 02042000 80000004 00000000 900000cc 00408400 21060000 00120000 00010270 |