On Target CNR1_HUMAN 0.4920635/CHEMBL2163946
For the given ligand Dolutegravir, we have found in our database that, being scored 0.4920635, the most similar ligand is CHEMBL2163946. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL2163946 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCC1COc2c(F)ccc3C(=O)C(=CN1c23)C(=O)NC45CC6CC(CC(C6)C4)C5 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 14000002 0180d808 60104108 02010712 00041012 06000074 06004001 22201400 02000001 c02008c0 01200004 40058000 00809806 08601000 11001441 000c600c 00220800 82004004 02602000 00064201 c0000020 38068e18 23810000 8650801c 01040440 c0000000 08800200 90040013 08400300 40078041 e00e0020 80000240 |