On Target NMDE2_HUMAN 0.2513661/CHEMBL444384
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.2513661, the most similar ligand is CHEMBL444384. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL444384 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | O=C(CN1CCC(Cc2ccccc2)CC1)c3c[nH]c4ccccc34 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000002 01801800 00100102 41010610 00041000 00000000 00002000 20000004 00500880 000908c0 08300004 5001a000 12008802 00600000 80000040 00040004 00000000 02000000 00200400 00000201 c0000100 18228208 20800000 9150001c 00042000 80000000 08000000 10000000 04000000 00060002 80044200 00002620 |