On Target GRM5_HUMAN 0.42083332/CHEMBL3928235
For the given ligand Dolutegravir, we have found in our database that, being scored 0.42083332, the most similar ligand is CHEMBL3928235. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3928235 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CC1(C)CN(CCO1)C(=O)c2ccc(cn2)C#Cc3cccc(F)c3 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 1000021a 00025808 00104900 d2090e10 044430a0 00100010 00000000 02003001 00000100 20002850 00290004 50008004 80008802 08101000 000a1408 020c010c 10000000 02000006 00200000 00800210 40000000 18838600 32802001 0240001c 00140404 c0000000 08800240 80000001 00400304 00068001 a0040000 00006300 |