On Target DRD3_HUMAN 0.41752577/CHEMBL238916
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.41752577, the most similar ligand is CHEMBL238916. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL238916 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | FC(F)(F)c1cccc(c1)N2CCN(CCCCN3C(=O)c4ccccc4S3(=O)=O)CC2 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004012 02801800 41180120 05b10600 000c0400 00200008 04000401 22001002 00200200 00403ad0 00302004 60128004 10008802 01002001 a0700440 00000000 02042080 02100000 08400000 00006611 c0100000 38068600 20000021 1a40001e 02042000 c0000004 40000000 9000008c 09408500 20060001 a0140000 00014370 |