On Target DRD3_HUMAN 0.48290598/CHEMBL495573
For the given ligand Dolutegravir, we have found in our database that, being scored 0.48290598, the most similar ligand is CHEMBL495573. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL495573 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | COc1cccc2cc3CN(CCCCN4CCn5c(cc6ccccc56)C4=O)CCn3c12 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00000002 0000bc08 60100108 50010e00 00041030 00100004 0e800000 22203001 00200000 000108c0 00290004 40078000 00009806 08500000 01020c41 0204010c 00004000 02000006 08200000 00060201 40000001 382f8618 20802001 8240801c 08110440 c0000000 00400000 90020000 08040304 00060051 a0040200 00004200 |