On Target 5HT2A_HUMAN 0.38842976/CHEMBL289061
For the given ligand Dolutegravir, we have found in our database that, being scored 0.38842976, the most similar ligand is CHEMBL289061. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL289061 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | COc1c2CNCCn2c3ccc(Cl)cc13 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 00008002 00008408 60100108 50010e00 00041030 00100104 0e000000 02203409 00200000 001108c0 08210004 40058800 0200180e 08400000 01020c41 0204210c 00004000 02000406 00200000 00060000 40000001 38218118 20800000 82408000 08106440 c0000000 00100000 80000000 08000304 00060050 04040200 00264200 |