On Target MDR1_HUMAN 0.355/CHEMBL472
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.355, the most similar ligand is CHEMBL472. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL472 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | COc1ccc(Cl)cc1C(=O)NCCc2ccc(cc2)S(=O)(=O)NC(=O)NC3CCCCC3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00008010 09801808 21100108 02b10e00 00001008 00020100 0e000000 02003404 00000080 001828c8 08202000 e0018c00 02009806 00000041 81200401 00002008 02002000 02000400 02402000 00026201 80002000 18278710 00000000 8950001c 00002000 c0000000 80100800 9000042c 04000700 20060803 a40c0000 00030660 |