On Target MDR1_HUMAN 0.41580757/CHEMBL1256399
For the given ligand Dolutegravir, we have found in our database that, being scored 0.41580757, the most similar ligand is CHEMBL1256399. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL1256399 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CC[C@H]1NC(=O)[C@@H](NC(=O)c2ncccc2O)[C@@H](C)OC(=O)[C@@H](NC(=O)[C@@H]3CC(=O)CCN3C(=O)[C@H](Cc4ccc(cc4)N(C)C)N(C)C(=O)[C@@H]5CCCN5C1=O)c6ccccc6 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0003805a 01807a08 60104300 d4010e00 000400e0 00320014 00000000 2220344d 00000880 001908c0 08390004 5001b000 1f00881e 0018a001 c01e1448 020c210c 18260000 02000003 0ca02018 00020201 c0010120 38278e30 33802083 8350001c 30103c01 c0000000 00808040 90000081 0c008306 0006000f a4046000 00806600 |