On Target AGTR2_HUMAN 0.33870968/CHEMBL263714
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.33870968, the most similar ligand is CHEMBL263714. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL263714 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CCCC1=Nc2ccc3NCCCCCCC(=O)NS(=O)(=O)c4ccc(CCC)cc4c5ccc(CN1C(=O)c2c3)cc5 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0001601a 01801201 01101100 11b10600 200c0029 00006028 00001800 00001000 86100908 504828e0 0930a00c 60819000 840a9808 02e00001 807300c0 020c000c 02062080 0600d008 0c682008 10016405 c0100100 18048638 31808041 99700418 02002004 c0000084 a0000000 100400ed 0400c404 20c6004a 402e5000 600106f0 |