On Target AGTR2_HUMAN 0.34628975/CHEMBL2435821
For the given ligand Dolutegravir, we have found in our database that, being scored 0.34628975, the most similar ligand is CHEMBL2435821. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL2435821 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCCc1nc2c(C)cc(cc2n1Cc3ccc(cc3)c4ccccc4C(=O)O)C(=O)NCCCN5CCOCC5 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0800a00a 00809e01 00101500 90050610 000c00e1 0000c000 10000000 02001004 80500100 100019f0 0120800c 40818800 82009882 00608000 200b14c8 0a0c010c 10020008 06800004 04680008 50010201 c0000000 180e8e30 33800041 8150041c 00044400 c0000000 08000040 80000041 04404304 00c60819 e00c8004 200006a0 |