On Target PRGR_HUMAN 0.44/CHEMBL3094480
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.44, the most similar ligand is CHEMBL3094480. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3094480 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CCC(Cc1ccc2ccccc2c1)NS(=O)(=O)c3c(C)cc(C)cc3C |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000050 21801000 01000102 01b10600 00080009 00000008 00010000 00000000 00000800 00480840 08102000 60008000 00000001 00200001 80300000 00000008 00002080 02000000 00400000 00006401 80000100 18000008 00000000 99400018 02002000 80000004 00000000 0000002c 04000400 20060002 00000000 00010660 |