On Target PRGR_HUMAN 0.38906753/CHEMBL3315068
For the given ligand Dolutegravir, we have found in our database that, being scored 0.38906753, the most similar ligand is CHEMBL3315068. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3315068 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CC(C)([C@@H]1c2ccc(nc2Oc3c(F)cccc13)c4ccc(nc4)C(=O)N5CCOCC5)C(=O)NC(=O)N |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0800201a 00015a38 20104108 d2818e10 840412a0 04100118 06002400 03483201 00402904 101828d0 08398004 50009850 84009882 08101800 21021d19 821c210c 10034800 02003006 04202408 10420207 45420100 38078600 33802000 0650041c 00141c03 e0680000 88800260 d0200041 005043a4 0006840b 920e0c20 04004700 |