On Target AA2AR_HUMAN 0.4051724/CHEMBL196665
For the given ligand Dolutegravir, we have found in our database that, being scored 0.4051724, the most similar ligand is CHEMBL196665. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL196665 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | Cc1ccc2c(O)c(cnc2n1)C(=O)NCc3ccc(F)cc3 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10000002 01808808 20104100 12010610 00041020 00024010 04004000 02001400 00000100 00100840 41200004 40008800 00008802 00d01000 00020440 020c200c 00022000 0200010c 00200000 40160200 c0000000 08068e28 20800000 8040010c 00040000 c0000000 08000040 80000001 00400104 00468001 c4040000 80240280 |