On Target CXCR1_HUMAN 0.3484163/CHEMBL221481
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.3484163, the most similar ligand is CHEMBL221481. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL221481 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CCC(CC)(NS(=O)(=O)c1c(C)ccc(N\C(=N\C#N)\Nc2ccccc2Br)c1O)N3CCOCC3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00004016 45808818 21500100 a3b10e40 00080280 00020008 0a000000 01002001 00060000 00402842 10202004 e0008440 00004012 00008049 803811d8 0008c308 30842a80 0a000000 08400000 00026701 d0023102 18012100 32020400 184b0018 0210a400 80000004 e0020800 0000048d 00008690 20060004 00000008 0c014268 |