On Target CXCR1_HUMAN 0.37244898/CHEMBL3609013
For the given ligand Metolazone, we have found in our database that, being scored 0.37244898, the most similar ligand is CHEMBL3609013. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL3609013 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | OB(O)c1ccc(CN(Cc2ccccc2)c3ccc(cn3)C(=O)Nc4ccc(F)cc4)nc1 |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 10004002 00a08800 00104182 92010e18 01061820 00100010 00004000 02003001 00000180 20000848 01298004 6000c000 40008802 04109000 00020d40 021c0104 00042000 03004006 08200000 00a00200 c0100000 0c048e00 21812800 0060000c 00160000 c0000081 0c0000c0 90000081 0060811c 00068801 80041000 80004220 |