On Target CXCR1_HUMAN 0.36434108/CHEMBL3609013
For the given ligand Dolutegravir, we have found in our database that, being scored 0.36434108, the most similar ligand is CHEMBL3609013. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3609013 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | OB(O)c1ccc(CN(Cc2ccccc2)c3ccc(cn3)C(=O)Nc4ccc(F)cc4)nc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10004002 00a08800 00104182 92010e18 01061820 00100010 00004000 02003001 00000180 20000848 01298004 6000c000 40008802 04109000 00020d40 021c0104 00042000 03004006 08200000 00a00200 c0100000 0c048e00 21812800 0060000c 00160000 c0000081 0c0000c0 90000081 0060811c 00068801 80041000 80004220 |