On Target DRD4_HUMAN 0.51428574/CHEMBL106917
For the given ligand Metolazone, we have found in our database that, being scored 0.51428574, the most similar ligand is CHEMBL106917. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL106917 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | CN(C)S(=O)(=O)c1ccc2N(CCc2c1)C(=O)CN3CCN(Cc4ccc(Cl)cc4)CC3 |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 0000c012 00803000 01102120 04b10600 20000110 00010040 00000000 0200100c 00800080 00090a40 08282024 6000e800 02008846 00102001 802205c0 00000100 0024a000 02000000 08400000 00006200 c0100000 38208700 20002023 8b40001b 00002000 c0000000 00040010 800010cc 0c088500 20060003 00044000 20030661 |