On Target TRY1_HUMAN 0.40101522/CHEMBL1160812
For the given ligand Metolazone, we have found in our database that, being scored 0.40101522, the most similar ligand is CHEMBL1160812. Check out the elaboration below.
| Metolazone (Given Ligand) | CHEMBL1160812 (Similar Ligand) |
|---|---|
| Cc1ccccc1N3C(=O)c2cc(S(N)(=O)=O)c(Cl)cc2NC3C | NC(=N)c1cccc(c1)N2CCCCN(C3CCN(CC3)S(=O)(=O)c4ccc(N)cc4)C2=O.OC(=O)C(F)(F)F.OC(=O)C(F)(F)F |
|
|
|
|
|
|
| 1000c016 00802801 01004100 03b10e40 00020130 40110042 08000004 02003009 01800000 20084840 01282004 6000c800 02008846 00100001 802204c0 00000100 00044000 03400022 08010000 00806801 c0100100 08038700 20032000 0844001c 00102000 c0080000 00040010 800010c8 00008100 20060001 80040000 c0034221 | 00004016 01803400 41100100 01b10e00 24080090 08002000 00000004 20003001 00a00100 004009f3 00282004 70038000 00009802 08100001 80e20040 00080008 00042000 02400000 08400040 00007607 c0100100 180d8e00 22022000 18400018 02150000 8000000c 40000000 900040cc 00408408 20060011 401c0000 00016270 |