On Target 5HT1B_HUMAN 0.33668342/CHEMBL342323
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.33668342, the most similar ligand is CHEMBL342323. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL342323 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | NCCc1c[nH]c2ccc(OCCCCCCNS(=O)(=O)c3ccc(cc3)c4ccc(cc4)S(=O)(=O)NCCCCCCOc5ccc6[nH]cc(CCN)c6c5)cc12 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 04002012 01801808 21000108 41b10710 000c1008 02000000 060c2000 00000004 00400000 004908c0 08002004 60018000 10800806 00c00001 91600041 000c200c 00822000 02000000 04602400 00026401 c0000000 18008018 31800000 99400018 02042000 80000004 08120000 0000006c 04004600 20060002 00040200 00010470 |