On Target TLR4_HUMAN 0.21674877/CHEMBL3823499
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.21674877, the most similar ligand is CHEMBL3823499. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3823499 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CC(C)(C)S(=O)(=O)c1ccc2nccc(Nc3n[nH]c4ccc(F)cc34)c2c1 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000003 04802208 20124000 02900200 01040000 00000030 02808010 00000008 00002100 10004840 8070a004 60008000 00000822 00441000 80600040 000c400e 04040000 00000000 08600002 00222801 c0080000 0c048008 20800800 88200019 00120000 00000080 22048000 008000c1 00008008 00068000 50040000 00014260 |