On Target TLR4_HUMAN 0.26881722/CHEMBL1223751
For the given ligand Dolutegravir, we have found in our database that, being scored 0.26881722, the most similar ligand is CHEMBL1223751. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL1223751 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCOc1ccc(OCC(O)CN(C)Cc2c(C)nn(Cc3ccccc3Cl)c2C)cc1 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0400800c 44001208 20100188 10010610 010810c0 02000002 0204c000 00003000 80100000 000008c0 02200008 40018800 02801826 00a00000 01240c01 000c200c 18221808 82800000 00c80000 00220200 00020800 3801a900 07800881 8b540010 00016001 c0000202 000ac000 90800000 05001304 00060008 200c0000 02020260 |