On Target OPRD_HUMAN 0.35638297/CHEMBL192998
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.35638297, the most similar ligand is CHEMBL192998. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL192998 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CN([C@H](CN1CC[C@H](O)C1)c2ccccc2)C(=O)Cc3ccc(CNS(=O)(=O)c4ccc(C)cc4)cc3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00000010 00803000 01180100 05b10600 00080088 00000010 04000001 22001008 00000180 000818c0 08302000 60009800 81008802 00002001 c0380400 00080008 10002000 02100000 00c00000 00006201 80000000 38208600 03000081 8b400018 02000001 c0000004 40000000 9000002c 0c000500 20060003 20042000 00012760 |