On Target CNR2_HUMAN 0.49377593/CHEMBL3409320
For the given ligand Dolutegravir, we have found in our database that, being scored 0.49377593, the most similar ligand is CHEMBL3409320. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL3409320 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCOCCN1C=C(C(=O)NC23CC4CC(CC(O)(C4)C2)C3)C(=O)c5cccc(OC)c15 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 10000002 0180d808 60104108 80010610 000c1012 00000064 12004000 22201000 02000001 c00008c0 01200004 40058000 00009806 09e80000 01001441 000c400c 00220000 82004004 02e02000 00060201 c0000020 18168e18 23810080 8450801c 00040441 c0000000 08800200 90040010 00400300 40060041 e00e0020 80000200 |