On Target CNR2_HUMAN 0.3298969/CHEMBL3421694
For the given ligand Hydralazine, we have found in our database that, being scored 0.3298969, the most similar ligand is CHEMBL3421694. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL3421694 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | CCCCCN1C=C2C(=O)N(CCCCC)N=C2c3ccccc13 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00000006 01000408 20004000 00000600 000c0000 00000060 06000000 00000000 06000000 c00008c0 0000000c 40018000 00009806 00e00000 000000c0 000d000c 00800000 0000c000 00600000 00220001 c0000000 1c018018 21800841 82300010 00102001 80000000 00000000 000c0000 00000000 00060000 000c0000 00004020 |