On Target NTRK1_HUMAN 0.38132295/CHEMBL2003524
For the given ligand Dolutegravir, we have found in our database that, being scored 0.38132295, the most similar ligand is CHEMBL2003524. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL2003524 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CCc1nc2C(=O)NC(=O)c2c3cc(OC)c(OC)cc13 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 1000000a 01808808 20004109 50010e10 00041021 00108002 060c4000 02003001 00000100 00080850 09298024 40808800 8000c886 00700000 010204c1 0204810c 00008000 02000026 00300000 00020a41 c0020000 08068e88 20802000 8040011c 00142000 c0200000 08320050 80001000 00400304 0006000b 80040000 a0004600 |