On Target OPRX_HUMAN 0.3529412/CHEMBL3942616
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.3529412, the most similar ligand is CHEMBL3942616. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL3942616 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | CN(C)C1(CCC(C)(CNS(=O)(=O)c2ccc(Cl)cc2)CC1)c3ccccc3 |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 00008010 01800200 01100102 01b10600 00080000 10000000 00000000 02001000 00000800 004808c0 08302000 60018800 02000804 00200001 80600000 00000000 00002000 02000000 02402000 00006401 80000100 18008130 00000000 18500018 02002000 80000004 10000000 9000000c 00000502 20060002 00060000 00030670 |