On Target OPRX_HUMAN 0.34545454/CHEMBL511232
For the given ligand Dolutegravir, we have found in our database that, being scored 0.34545454, the most similar ligand is CHEMBL511232. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL511232 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | COC(=O)NC1(C[C@H]2CC[C@H](C1)N2C(c3ccccc3Cl)c4ccccc4Cl)c5ccc(F)cn5 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 0000800a 01801e00 00104102 96010e00 00040020 00108030 01000020 23001001 00000a00 800809e0 08318004 50818800 02008806 00201000 00020400 0216010d 00020000 06082180 00202018 00100a01 e0100d00 180c8dd0 20800000 0050001c 00102000 e0000202 00200040 d0001181 00000386 0086001b ac060800 20026600 |