On Target OPRX_HUMAN 0.33093524/CHEMBL3942616
For the given ligand Hydrochlorothiazide, we have found in our database that, being scored 0.33093524, the most similar ligand is CHEMBL3942616. Check out the elaboration below.
| Hydrochlorothiazide (Given Ligand) | CHEMBL3942616 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc2c(cc1Cl)NCNS2(=O)=O | CN(C)C1(CCC(C)(CNS(=O)(=O)c2ccc(Cl)cc2)CC1)c3ccccc3 |
|
|
|
|
|
|
| 0000c012 00802200 01000000 02b00a20 00000010 14000000 08000000 00002009 40000010 00007840 00202004 a0008800 02008006 00000041 90220040 00000000 00042100 00000000 0a400000 00006000 c0002000 08010100 20000000 08500008 00106010 00080040 100000a0 000004cc 00008400 60060080 0000c000 00034060 | 00008010 01800200 01100102 01b10600 00080000 10000000 00000000 02001000 00000800 004808c0 08302000 60018800 02000804 00200001 80600000 00000000 00002000 02000000 02402000 00006401 80000100 18008130 00000000 18500018 02002000 80000004 10000000 9000000c 00000502 20060002 00060000 00030670 |