On Target FYN_HUMAN 0.3592233/CHEMBL373798
For the given ligand Hydralazine, we have found in our database that, being scored 0.3592233, the most similar ligand is CHEMBL373798. Check out the elaboration below.
| Hydralazine (Given Ligand) | CHEMBL373798 (Similar Ligand) |
|---|---|
| NNc1nncc2ccccc12 | Nc1n[nH]c2cccc(c3ccc(NC(=O)Nc4cccc(F)c4)cc3)c12 |
|
|
|
|
|
|
| 00000003 00000008 20000000 00000200 008c0000 00000000 02000000 00000000 00000000 10000840 00000004 20008000 00000002 00400000 00000040 0004400c 00000000 00000008 00200000 00320408 40000000 0c000008 60800800 00200000 00120000 00000000 40000000 00000000 00000018 000e0000 00000000 00004000 | 00002007 00000808 20100100 02010a40 00040104 00000010 02000000 00002001 08000000 10004840 00280004 60008000 00018012 00509000 00000040 0004400c 00060000 02000000 0c600000 00220000 40000100 0c020408 30822800 00600008 00160000 80080000 00060240 000000c1 0000c008 00068001 00000000 00004260 |