On Target CAH2_HUMAN 0.5838509/CHEMBL1054
For the given ligand Bendroflumethiazide, we have found in our database that, being scored 0.5838509, the most similar ligand is CHEMBL1054. Check out the elaboration below.
| Bendroflumethiazide (Given Ligand) | CHEMBL1054 (Similar Ligand) |
|---|---|
| NS(=O)(=O)c1cc3c(cc1C(F)(F)F)NC(Cc2ccccc2)NS3(=O)=O | NS(=O)(=O)c1cc2c(NC(NS2(=O)=O)C(Cl)Cl)cc1Cl |
|
|
|
|
|
|
| 00004052 20803002 41100100 03b10e20 20080018 04000000 08010400 00012009 40000010 00483850 0820200c e0008004 40008001 09000041 90320040 00000000 00042180 02000000 0a400000 00006410 c0102000 18210000 20000000 99500019 02146018 80000144 000000a0 900004ec 04408400 62060082 0010e000 00014660 | 0004c012 00802202 01002000 03b00e20 00080012 14000000 08000000 00002009 40080030 00007840 00202004 e0008800 02009006 00000041 90220040 00000000 00042100 00040100 0a400000 00006000 c0102000 08010100 20000000 08500008 02106058 08080044 100000a0 000004cc 00008400 62060080 0000e000 00034260 |