On Target CAH2_HUMAN 0.41156462/CHEMBL217232
For the given ligand Dolutegravir, we have found in our database that, being scored 0.41156462, the most similar ligand is CHEMBL217232. Check out the elaboration below.
| Dolutegravir (Given Ligand) | CHEMBL217232 (Similar Ligand) |
|---|---|
| C[C@@H]3CCO[C@H]4Cn2cc(C(=O)NCc1ccc(F)cc1F)c(=O)c(O)c2C(=O)N34 | CC(=O)N[C@@H]1[C@@H](O)[C@H](O)[C@@H](CO)O[C@H]1n2cc(CNC(=O)c3ccc(cc3)S(=O)(=O)N)nn2 |
|
|
|
|
|
|
| 10000082 44c0fc08 60104100 d2010f90 0404102a 08128154 1c024000 82203401 02200301 805308d0 01290004 c0018000 80009806 08581100 00021c80 221e710c 02226200 82004106 00e00800 00160201 c0000021 383f8e10 23802081 6654013c 18152401 c0001082 08e00260 90240011 08440304 45068051 e40c0000 c0004200 | 08000010 55c07c18 61500102 c0b10f10 803800f8 00000100 04004800 a2003401 00200000 119008d0 00212000 60618800 0000988e 01880101 80211c08 001db00c 10222040 82000081 19c02000 00043201 841a0020 381e8e10 17201080 0e54001c 10204441 c0000002 00c00200 b0002069 0a000304 20061111 940c0000 04018a22 |